![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| PROPOSALS/ | 2018-05-29 15:40 | - | |
| Game Analysis Outline.doc | 2018-05-29 15:40 | 28K | |
| Schedule -- remainder of term.pdf | 2018-05-29 15:40 | 47K | |
| Preliminary Schedule.pdf | 2018-05-29 15:40 | 51K | |
| Book list.pdf | 2018-05-29 15:40 | 66K | |
| Game_08.pdf | 2018-05-29 15:40 | 99K | |
| Midterm report - team.pdf | 2018-05-29 15:40 | 134K | |
| GameDesignLessonPlan.pdf | 2018-05-29 15:40 | 272K | |
| Interface in Games.pdf | 2018-05-29 15:40 | 439K | |
| Game Development --First steps.pdf | 2018-05-29 15:40 | 604K | |
| The Role of Story.pdf | 2018-05-29 15:40 | 649K | |
| Games -- What Are They.pdf | 2018-05-29 15:40 | 702K | |
| Characters in Games.pdf | 2018-05-29 15:40 | 932K | |
| Game World & Structure.pdf | 2018-05-29 15:40 | 972K | |
| Gameplay.pdf | 2018-05-29 15:40 | 1.0M | |